C47H31N3O2Si — CID 167410143
2-dibenzofuran-3-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 167410143) has the molecular formula C47H31N3O2Si and a molecular weight of 697.87 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 167410143 |
| Molecular Formula | C47H31N3O2Si |
| Molecular Weight | 697.87 g/mol |
| Exact Mass | 697.22 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2c1cc(-c1nc(-c3cccc(-c4ccccc4)c3)nc(-c3ccc4c(c3)oc3ccccc34)n1)c1c2oc2ccccc21 |
| InChI | InChI=1S/C47H31N3O2Si/c1-53(2)40-22-11-8-19-35(40)43-41(53)27-36(42-34-18-7-10-21-38(34)52-44(42)43)47-49-45(30-16-12-15-29(25-30)28-13-4-3-5-14-28)48-46(50-47)31-23-24-33-32-17-6-9-20-37(32)51-39(33)26-31/h3-27H,1-2H3 |
| InChIKey | CYOAEOIEPXSEAR-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.87 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|