C41H27N3OSSi — CID 167410196
2-dibenzothiophen-1-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-phenyl-1,3,5-triazine (PubChem CID 167410196) has the molecular formula C41H27N3OSSi and a molecular weight of 637.84 g/mol. Its IUPAC name is 2-dibenzothiophen-1-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-1-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 167410196 |
| Molecular Formula | C41H27N3OSSi |
| Molecular Weight | 637.84 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | 2-dibenzothiophen-1-yl-4-(9,9-dimethyl-20-oxa-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaen-12-yl)-6-phenyl-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2c1cc(-c1nc(-c3ccccc3)nc(-c3cccc4sc5ccccc5c34)n1)c1c2oc2ccccc21 |
| InChI | InChI=1S/C41H27N3OSSi/c1-47(2)33-22-11-8-17-27(33)37-34(47)23-29(36-25-15-6-9-19-30(25)45-38(36)37)41-43-39(24-13-4-3-5-14-24)42-40(44-41)28-18-12-21-32-35(28)26-16-7-10-20-31(26)46-32/h3-23H,1-2H3 |
| InChIKey | KJYLVVAMIKANBK-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.84 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|