C22H26N6 — CID 156661505
1,3-bis(5-tert-butyl-1H-pyrazol-3-yl)-2,6-naphthyridine (PubChem CID 156661505) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1,3-bis(5-tert-butyl-1H-pyrazol-3-yl)-2,6-naphthyridine.
| Compound Name | 1,3-bis(5-tert-butyl-1H-pyrazol-3-yl)-2,6-naphthyridine |
|---|---|
| PubChem CID | 156661505 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1,3-bis(5-tert-butyl-1H-pyrazol-3-yl)-2,6-naphthyridine |
| SMILES | CC(C)(C)c1cc(-c2cc3cnccc3c(-c3cc(C(C)(C)C)[nH]n3)n2)n[nH]1 |
| InChI | InChI=1S/C22H26N6/c1-21(2,3)18-10-16(25-27-18)15-9-13-12-23-8-7-14(13)20(24-15)17-11-19(28-26-17)22(4,5)6/h7-12H,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | IIVKTNYMXSDGGA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |