About 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid
2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 156663542) has the molecular formula C7H13NO2S
and a molecular weight of 178.27 g/mol. Its IUPAC name is 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid.
Analyze 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid (CID 156663542) is 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid is [2H]CC1NC(C(=O)O)C(C[2H])(C[2H])S1.
What is the InChIKey of 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is MQQSPQRNCBFBSG-CBYSEHNBSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-4-8-5(6(9)10)7(2,3)11-4/h4-5,8H,1-3H3,(H,9,10)/i1D,2D,3D.
What are the key properties of 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid?
2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 178.27 g/mol, XLogP of 0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,5-tris(deuteriomethyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 156663542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).