C36H42CoN12+2 — CID 156663962
cobalt(2+);1,4,7-tris[(1-benzyltriazol-4-yl)methyl]-1,4,7-triazonane (PubChem CID 156663962) has the molecular formula C36H42CoN12+2 and a molecular weight of 701.75 g/mol. Its IUPAC name is cobalt(2+);1,4,7-tris[(1-benzyltriazol-4-yl)methyl]-1,4,7-triazonane.
| Compound Name | cobalt(2+);1,4,7-tris[(1-benzyltriazol-4-yl)methyl]-1,4,7-triazonane |
|---|---|
| PubChem CID | 156663962 |
| Molecular Formula | C36H42CoN12+2 |
| Molecular Weight | 701.75 g/mol |
| Exact Mass | 701.30 |
| IUPAC Name | cobalt(2+);1,4,7-tris[(1-benzyltriazol-4-yl)methyl]-1,4,7-triazonane |
| SMILES | [Co+2].c1ccc(Cn2cc(CN3CCN(Cc4cn(Cc5ccccc5)nn4)CCN(Cc4cn(Cc5ccccc5)nn4)CC3)nn2)cc1 |
| InChI | InChI=1S/C36H42N12.Co/c1-4-10-31(11-5-1)22-46-28-34(37-40-46)25-43-16-18-44(26-35-29-47(41-38-35)23-32-12-6-2-7-13-32)20-21-45(19-17-43)27-36-30-48(42-39-36)24-33-14-8-3-9-15-33;/h1-15,28-30H,16-27H2;/q;+2 |
| InChIKey | CMDVRLPYOVVSAM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |