C14H13BrFN5O5 — CID 156664150
4-(3-bromo-4-fluorophenyl)-3-[4-(4-hydroxybutoxyamino)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one (PubChem CID 156664150) has the molecular formula C14H13BrFN5O5 and a molecular weight of 430.19 g/mol. Its IUPAC name is 4-(3-bromo-4-fluorophenyl)-3-[4-(4-hydroxybutoxyamino)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one.
| Compound Name | 4-(3-bromo-4-fluorophenyl)-3-[4-(4-hydroxybutoxyamino)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 156664150 |
| Molecular Formula | C14H13BrFN5O5 |
| Molecular Weight | 430.19 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 4-(3-bromo-4-fluorophenyl)-3-[4-(4-hydroxybutoxyamino)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
| SMILES | O=c1onc(-c2nonc2NOCCCCO)n1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H13BrFN5O5/c15-9-7-8(3-4-10(9)16)21-13(20-25-14(21)23)11-12(19-26-17-11)18-24-6-2-1-5-22/h3-4,7,22H,1-2,5-6H2,(H,18,19) |
| InChIKey | GJHHJLZMFVEMMN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|