C16H33N2O4Y- — CID 156664362
N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-pentylacetamide;yttrium (PubChem CID 156664362) has the molecular formula C16H33N2O4Y- and a molecular weight of 406.36 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-pentylacetamide;yttrium.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-pentylacetamide;yttrium |
|---|---|
| PubChem CID | 156664362 |
| Molecular Formula | C16H33N2O4Y- |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-pentylacetamide;yttrium |
| SMILES | CC(C)(C)C(=O)NCCOCCO.[CH2-]C(=O)NCCCCC.[Y] |
| InChI | InChI=1S/C9H19NO3.C7H14NO.Y/c1-9(2,3)8(12)10-4-6-13-7-5-11;1-3-4-5-6-8-7(2)9;/h11H,4-7H2,1-3H3,(H,10,12);2-6H2,1H3,(H,8,9);/q;-1; |
| InChIKey | WZXJKUGHBWIZJR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|