C19H31N2O4Y- — CID 156664424
N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-[(3-methylphenyl)methyl]acetamide;yttrium (PubChem CID 156664424) has the molecular formula C19H31N2O4Y- and a molecular weight of 440.37 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-[(3-methylphenyl)methyl]acetamide;yttrium.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-[(3-methylphenyl)methyl]acetamide;yttrium |
|---|---|
| PubChem CID | 156664424 |
| Molecular Formula | C19H31N2O4Y- |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2,2-dimethylpropanamide;N-[(3-methylphenyl)methyl]acetamide;yttrium |
| SMILES | CC(C)(C)C(=O)NCCOCCO.[CH2-]C(=O)NCc1cccc(C)c1.[Y] |
| InChI | InChI=1S/C10H12NO.C9H19NO3.Y/c1-8-4-3-5-10(6-8)7-11-9(2)12;1-9(2,3)8(12)10-4-6-13-7-5-11;/h3-6H,2,7H2,1H3,(H,11,12);11H,4-7H2,1-3H3,(H,10,12);/q-1;; |
| InChIKey | QYFCIMQRINSGTK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|