C16H26N2O4 — CID 122152484
2-[2-(2-hydroxyethoxy)ethyl-(2-hydroxyethyl)amino]-N-[(3-methylphenyl)methyl]acetamide (PubChem CID 122152484) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethyl-(2-hydroxyethyl)amino]-N-[(3-methylphenyl)methyl]acetamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethyl-(2-hydroxyethyl)amino]-N-[(3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 122152484 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethyl-(2-hydroxyethyl)amino]-N-[(3-methylphenyl)methyl]acetamide |
| SMILES | Cc1cccc(CNC(=O)CN(CCO)CCOCCO)c1 |
| InChI | InChI=1S/C16H26N2O4/c1-14-3-2-4-15(11-14)12-17-16(21)13-18(5-7-19)6-9-22-10-8-20/h2-4,11,19-20H,5-10,12-13H2,1H3,(H,17,21) |
| InChIKey | DGQSRJAFFGOIGP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|