C11H16BN3O3S — CID 156666117
[3-[2-(methylcarbamothioylamino)ethylcarbamoyl]phenyl]boronic acid (PubChem CID 156666117) has the molecular formula C11H16BN3O3S and a molecular weight of 281.15 g/mol. Its IUPAC name is [3-[2-(methylcarbamothioylamino)ethylcarbamoyl]phenyl]boronic acid.
| Compound Name | [3-[2-(methylcarbamothioylamino)ethylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 156666117 |
| Molecular Formula | C11H16BN3O3S |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | [3-[2-(methylcarbamothioylamino)ethylcarbamoyl]phenyl]boronic acid |
| SMILES | CNC(=S)NCCNC(=O)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C11H16BN3O3S/c1-13-11(19)15-6-5-14-10(16)8-3-2-4-9(7-8)12(17)18/h2-4,7,17-18H,5-6H2,1H3,(H,14,16)(H2,13,15,19) |
| InChIKey | IWUOOZVZZIIJEB-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|