C51H39FIrN4OSi-2 — CID 156668805
6-[1-[(2,6-diphenylphenyl)methyl]benzimidazol-2-yl]-3-fluoro-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 156668805) has the molecular formula C51H39FIrN4OSi-2 and a molecular weight of 963.20 g/mol. Its IUPAC name is 6-[1-[(2,6-diphenylphenyl)methyl]benzimidazol-2-yl]-3-fluoro-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 6-[1-[(2,6-diphenylphenyl)methyl]benzimidazol-2-yl]-3-fluoro-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 156668805 |
| Molecular Formula | C51H39FIrN4OSi-2 |
| Molecular Weight | 963.20 g/mol |
| Exact Mass | 963.25 |
| IUPAC Name | 6-[1-[(2,6-diphenylphenyl)methyl]benzimidazol-2-yl]-3-fluoro-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Fc1cc2oc3c(-c4nc5ccccc5n4Cc4c(-c5ccccc5)cccc4-c4ccccc4)[c-]ccc3c2cn1.[Ir] |
| InChI | InChI=1S/C37H23FN3O.C14H16NSi.Ir/c38-35-21-34-30(22-39-35)28-17-10-18-29(36(28)42-34)37-40-32-19-7-8-20-33(32)41(37)23-31-26(24-11-3-1-4-12-24)15-9-16-27(31)25-13-5-2-6-14-25;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h1-17,19-22H,23H2;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | VNBGVEKQQQONDY-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.20 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|