C50H37FIrN4OSi-2 — CID 156671114
6-[1-(2,5-diphenylphenyl)-7-fluorobenzimidazol-2-yl]-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 156671114) has the molecular formula C50H37FIrN4OSi-2 and a molecular weight of 949.17 g/mol. Its IUPAC name is 6-[1-(2,5-diphenylphenyl)-7-fluorobenzimidazol-2-yl]-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 6-[1-(2,5-diphenylphenyl)-7-fluorobenzimidazol-2-yl]-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 156671114 |
| Molecular Formula | C50H37FIrN4OSi-2 |
| Molecular Weight | 949.17 g/mol |
| Exact Mass | 949.24 |
| IUPAC Name | 6-[1-(2,5-diphenylphenyl)-7-fluorobenzimidazol-2-yl]-7H-[1]benzofuro[3,2-c]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Fc1cccc2nc(-c3[c-]ccc4c3oc3ccncc34)n(-c3cc(-c4ccccc4)ccc3-c3ccccc3)c12.[Ir] |
| InChI | InChI=1S/C36H21FN3O.C14H16NSi.Ir/c37-30-15-8-16-31-34(30)40(36(39-31)28-14-7-13-27-29-22-38-20-19-33(29)41-35(27)28)32-21-25(23-9-3-1-4-10-23)17-18-26(32)24-11-5-2-6-12-24;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h1-13,15-22H;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | KSDHDYLVXWGBCR-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.17 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|