C6H10N2O — CID 15667203
1,3-dimethyl-4H-pyrimidin-2-one (PubChem CID 15667203) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 1,3-dimethyl-4H-pyrimidin-2-one.
| Compound Name | 1,3-dimethyl-4H-pyrimidin-2-one |
|---|---|
| PubChem CID | 15667203 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1,3-dimethyl-4H-pyrimidin-2-one |
| SMILES | CN1C=CCN(C)C1=O |
| InChI | InChI=1S/C6H10N2O/c1-7-4-3-5-8(2)6(7)9/h3-4H,5H2,1-2H3 |
| InChIKey | SFLZYXZRWZUTSC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |