C37H36GeIrN4O-2 — CID 156672335
6-(1-tert-butylbenzimidazol-2-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 156672335) has the molecular formula C37H36GeIrN4O-2 and a molecular weight of 817.55 g/mol. Its IUPAC name is 6-(1-tert-butylbenzimidazol-2-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 6-(1-tert-butylbenzimidazol-2-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 156672335 |
| Molecular Formula | C37H36GeIrN4O-2 |
| Molecular Weight | 817.55 g/mol |
| Exact Mass | 819.17 |
| IUPAC Name | 6-(1-tert-butylbenzimidazol-2-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1ccc2c(n1)oc1c[c-]c(-c3nc4ccccc4n3C(C)(C)C)cc12.[Ir] |
| InChI | InChI=1S/C23H20N3O.C14H16GeN.Ir/c1-14-9-11-16-17-13-15(10-12-20(17)27-22(16)24-14)21-25-18-7-5-6-8-19(18)26(21)23(2,3)4;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h5-9,11-13H,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | AXIGPVFEYQZPJH-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.55 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|