C39H31FGeIrN4O-2 — CID 156669314
8-(1-benzylbenzimidazol-2-yl)-5-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 156669314) has the molecular formula C39H31FGeIrN4O-2 and a molecular weight of 855.53 g/mol. Its IUPAC name is 8-(1-benzylbenzimidazol-2-yl)-5-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 8-(1-benzylbenzimidazol-2-yl)-5-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 156669314 |
| Molecular Formula | C39H31FGeIrN4O-2 |
| Molecular Weight | 855.53 g/mol |
| Exact Mass | 857.13 |
| IUPAC Name | 8-(1-benzylbenzimidazol-2-yl)-5-fluoro-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Fc1c[c-]c(-c2nc3ccccc3n2Cc2ccccc2)c2oc3ncccc3c12.[Ir] |
| InChI | InChI=1S/C25H15FN3O.C14H16GeN.Ir/c26-19-13-12-18(23-22(19)17-9-6-14-27-25(17)30-23)24-28-20-10-4-5-11-21(20)29(24)15-16-7-2-1-3-8-16;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-11,13-14H,15H2;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | XKLHNACXOVYZPA-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.53 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|