C19H20NS2+ — CID 156672478
2,2-bis(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-ium (PubChem CID 156672478) has the molecular formula C19H20NS2+ and a molecular weight of 326.51 g/mol. Its IUPAC name is 2,2-bis(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-ium.
| Compound Name | 2,2-bis(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-ium |
|---|---|
| PubChem CID | 156672478 |
| Molecular Formula | C19H20NS2+ |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2,2-bis(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-ium |
| SMILES | c1csc(C[N+]2(Cc3cccs3)CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H20NS2/c1-2-6-17-13-20(10-9-16(17)5-1,14-18-7-3-11-21-18)15-19-8-4-12-22-19/h1-8,11-12H,9-10,13-15H2/q+1 |
| InChIKey | KUQRQEFDPWPSAJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|