C14H13NOS — CID 21082383
N-(thiophen-2-ylmethoxy)-1,3-dihydroinden-2-imine (PubChem CID 21082383) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(thiophen-2-ylmethoxy)-1,3-dihydroinden-2-imine.
| Compound Name | N-(thiophen-2-ylmethoxy)-1,3-dihydroinden-2-imine |
|---|---|
| PubChem CID | 21082383 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(thiophen-2-ylmethoxy)-1,3-dihydroinden-2-imine |
| SMILES | c1csc(CON=C2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C14H13NOS/c1-2-5-12-9-13(8-11(12)4-1)15-16-10-14-6-3-7-17-14/h1-7H,8-10H2 |
| InChIKey | LFVCPTVEPSPIMG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|