C31H32F2N4O2 — CID 156674399
2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-5-(1-phenylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine (PubChem CID 156674399) has the molecular formula C31H32F2N4O2 and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-5-(1-phenylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine.
| Compound Name | 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-5-(1-phenylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 156674399 |
| Molecular Formula | C31H32F2N4O2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-5-(1-phenylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c([N+](=O)[O-])cc1F)CN(C(CC)c1ccccc1)CC2 |
| InChI | InChI=1S/C31H32F2N4O2/c1-4-20-13-10-14-21(5-2)30(20)36-31(23-17-26(33)29(37(38)39)18-25(23)32)24-19-35(16-15-27(24)34-36)28(6-3)22-11-8-7-9-12-22/h7-14,17-18,28H,4-6,15-16,19H2,1-3H3 |
| InChIKey | PIYPUSALKYLRPL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|