C19H36N2O — CID 156675292
2-tert-butyl-7-[(3-methoxycyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine (PubChem CID 156675292) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-tert-butyl-7-[(3-methoxycyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine.
| Compound Name | 2-tert-butyl-7-[(3-methoxycyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 156675292 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | 2-tert-butyl-7-[(3-methoxycyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine |
| SMILES | COC1CCCC(CN2CCCC3CC(C(C)(C)C)NC32)C1 |
| InChI | InChI=1S/C19H36N2O/c1-19(2,3)17-12-15-8-6-10-21(18(15)20-17)13-14-7-5-9-16(11-14)22-4/h14-18,20H,5-13H2,1-4H3 |
| InChIKey | HITFADUXWSUOJC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |