C18H33ClN2 — CID 156675284
2-tert-butyl-7-[(4-chlorocyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine (PubChem CID 156675284) has the molecular formula C18H33ClN2 and a molecular weight of 312.93 g/mol. Its IUPAC name is 2-tert-butyl-7-[(4-chlorocyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine.
| Compound Name | 2-tert-butyl-7-[(4-chlorocyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 156675284 |
| Molecular Formula | C18H33ClN2 |
| Molecular Weight | 312.93 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-tert-butyl-7-[(4-chlorocyclohexyl)methyl]-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine |
| SMILES | CC(C)(C)C1CC2CCCN(CC3CCC(Cl)CC3)C2N1 |
| InChI | InChI=1S/C18H33ClN2/c1-18(2,3)16-11-14-5-4-10-21(17(14)20-16)12-13-6-8-15(19)9-7-13/h13-17,20H,4-12H2,1-3H3 |
| InChIKey | JZGYCOXDYHSJDX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|