About 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine
3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine (PubChem CID 163180640) has the molecular formula C10H19ClN2S
and a molecular weight of 234.80 g/mol. Its IUPAC name is 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine.
Molecular Properties
| Compound Name | 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine |
| PubChem CID | 163180640 |
| Molecular Formula | C10H19ClN2S |
| Molecular Weight | 234.80 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine |
| SMILES | NC1SCCN1CC1CCC(Cl)CC1 |
| InChI | InChI=1S/C10H19ClN2S/c11-9-3-1-8(2-4-9)7-13-5-6-14-10(13)12/h8-10H,1-7,12H2 |
| InChIKey | UHPNRSWVYQBLGF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine?
The IUPAC name of 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine (CID 163180640) is 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine.
What is the SMILES notation for 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine?
The canonical SMILES for 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine is NC1SCCN1CC1CCC(Cl)CC1.
What is the InChIKey of 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine?
The InChIKey is UHPNRSWVYQBLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClN2S/c11-9-3-1-8(2-4-9)7-13-5-6-14-10(13)12/h8-10H,1-7,12H2.
What are the key properties of 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine?
3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine has a molecular weight of 234.80 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chlorocyclohexyl)methyl]-1,3-thiazolidin-2-amine is sourced from PubChem (CID 163180640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).