C11H20N3O3S- — CID 163146359
2-(2-amino-1,3-thiazolidin-3-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone (PubChem CID 163146359) has the molecular formula C11H20N3O3S- and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazolidin-3-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone.
| Compound Name | 2-(2-amino-1,3-thiazolidin-3-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 163146359 |
| Molecular Formula | C11H20N3O3S- |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-(2-amino-1,3-thiazolidin-3-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone |
| SMILES | NC1SCCN1CC(=O)C1CCC(N([O-])O)CC1 |
| InChI | InChI=1S/C11H20N3O3S/c12-11-13(5-6-18-11)7-10(15)8-1-3-9(4-2-8)14(16)17/h8-9,11,16H,1-7,12H2/q-1 |
| InChIKey | DNNMTHJDLMHLMM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|