C13H22Cl2N2O — CID 163165853
2-(2-aminopiperidin-1-yl)-1-(3,4-dichlorocyclohexyl)ethanone (PubChem CID 163165853) has the molecular formula C13H22Cl2N2O and a molecular weight of 293.24 g/mol. Its IUPAC name is 2-(2-aminopiperidin-1-yl)-1-(3,4-dichlorocyclohexyl)ethanone.
| Compound Name | 2-(2-aminopiperidin-1-yl)-1-(3,4-dichlorocyclohexyl)ethanone |
|---|---|
| PubChem CID | 163165853 |
| Molecular Formula | C13H22Cl2N2O |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-(2-aminopiperidin-1-yl)-1-(3,4-dichlorocyclohexyl)ethanone |
| SMILES | NC1CCCCN1CC(=O)C1CCC(Cl)C(Cl)C1 |
| InChI | InChI=1S/C13H22Cl2N2O/c14-10-5-4-9(7-11(10)15)12(18)8-17-6-2-1-3-13(17)16/h9-11,13H,1-8,16H2 |
| InChIKey | GDKGSLZEYFMCKF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|