C13H23IN3O3- — CID 163121886
2-(2-amino-5-iodopiperidin-1-yl)-1-[3-[hydroxy(oxido)amino]cyclohexyl]ethanone (PubChem CID 163121886) has the molecular formula C13H23IN3O3- and a molecular weight of 396.25 g/mol. Its IUPAC name is 2-(2-amino-5-iodopiperidin-1-yl)-1-[3-[hydroxy(oxido)amino]cyclohexyl]ethanone.
| Compound Name | 2-(2-amino-5-iodopiperidin-1-yl)-1-[3-[hydroxy(oxido)amino]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 163121886 |
| Molecular Formula | C13H23IN3O3- |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-(2-amino-5-iodopiperidin-1-yl)-1-[3-[hydroxy(oxido)amino]cyclohexyl]ethanone |
| SMILES | NC1CCC(I)CN1CC(=O)C1CCCC(N([O-])O)C1 |
| InChI | InChI=1S/C13H23IN3O3/c14-10-4-5-13(15)16(7-10)8-12(18)9-2-1-3-11(6-9)17(19)20/h9-11,13,19H,1-8,15H2/q-1 |
| InChIKey | HBXQYFFXIIHZNB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|