C15H27N2O3- — CID 163140990
2-(3,5-dimethylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone (PubChem CID 163140990) has the molecular formula C15H27N2O3- and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 163140990 |
| Molecular Formula | C15H27N2O3- |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone |
| SMILES | CC1CC(C)CN(CC(=O)C2CCC(N([O-])O)CC2)C1 |
| InChI | InChI=1S/C15H27N2O3/c1-11-7-12(2)9-16(8-11)10-15(18)13-3-5-14(6-4-13)17(19)20/h11-14,19H,3-10H2,1-2H3/q-1 |
| InChIKey | ZDDPNPQDIMQRIV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|