C14H26N3O3- — CID 163178219
2-(2-amino-3-methylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone (PubChem CID 163178219) has the molecular formula C14H26N3O3- and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(2-amino-3-methylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone.
| Compound Name | 2-(2-amino-3-methylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 163178219 |
| Molecular Formula | C14H26N3O3- |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-(2-amino-3-methylpiperidin-1-yl)-1-[4-[hydroxy(oxido)amino]cyclohexyl]ethanone |
| SMILES | CC1CCCN(CC(=O)C2CCC(N([O-])O)CC2)C1N |
| InChI | InChI=1S/C14H26N3O3/c1-10-3-2-8-16(14(10)15)9-13(18)11-4-6-12(7-5-11)17(19)20/h10-12,14,19H,2-9,15H2,1H3/q-1 |
| InChIKey | GHECJULEVJCRDK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|