C22H38IN5O6-2 — CID 163119148
ethyl 1-[2-[[2,4-bis[hydroxy(oxido)amino]cyclohexyl]hydrazinylidene]-2-(4-iodocyclohexyl)ethyl]piperidine-3-carboxylate (PubChem CID 163119148) has the molecular formula C22H38IN5O6-2 and a molecular weight of 595.48 g/mol. Its IUPAC name is ethyl 1-[2-[[2,4-bis[hydroxy(oxido)amino]cyclohexyl]hydrazinylidene]-2-(4-iodocyclohexyl)ethyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[[2,4-bis[hydroxy(oxido)amino]cyclohexyl]hydrazinylidene]-2-(4-iodocyclohexyl)ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 163119148 |
| Molecular Formula | C22H38IN5O6-2 |
| Molecular Weight | 595.48 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | ethyl 1-[2-[[2,4-bis[hydroxy(oxido)amino]cyclohexyl]hydrazinylidene]-2-(4-iodocyclohexyl)ethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CC(=NNC2CCC(N([O-])O)CC2N([O-])O)C2CCC(I)CC2)C1 |
| InChI | InChI=1S/C22H38IN5O6/c1-2-34-22(29)16-4-3-11-26(13-16)14-20(15-5-7-17(23)8-6-15)25-24-19-10-9-18(27(30)31)12-21(19)28(32)33/h15-19,21,24,30,32H,2-14H2,1H3/q-2 |
| InChIKey | ZCPUPDCDSWSNAN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 146.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|