C22H37N2O5- — CID 163128493
2-[3-(cyclohexanecarbonyl)piperidin-1-yl]-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone (PubChem CID 163128493) has the molecular formula C22H37N2O5- and a molecular weight of 409.55 g/mol. Its IUPAC name is 2-[3-(cyclohexanecarbonyl)piperidin-1-yl]-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone.
| Compound Name | 2-[3-(cyclohexanecarbonyl)piperidin-1-yl]-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 163128493 |
| Molecular Formula | C22H37N2O5- |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 2-[3-(cyclohexanecarbonyl)piperidin-1-yl]-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone |
| SMILES | CCOC1CCC(C(=O)CN2CCCC(C(=O)C3CCCCC3)C2)CC1N([O-])O |
| InChI | InChI=1S/C22H37N2O5/c1-2-29-21-11-10-17(13-19(21)24(27)28)20(25)15-23-12-6-9-18(14-23)22(26)16-7-4-3-5-8-16/h16-19,21,27H,2-15H2,1H3/q-1 |
| InChIKey | FCNXITUFAIMIKO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|