C17H31N2O4- — CID 163124821
2-(2,4-dimethylpiperidin-1-yl)-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone (PubChem CID 163124821) has the molecular formula C17H31N2O4- and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-(2,4-dimethylpiperidin-1-yl)-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone.
| Compound Name | 2-(2,4-dimethylpiperidin-1-yl)-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 163124821 |
| Molecular Formula | C17H31N2O4- |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-(2,4-dimethylpiperidin-1-yl)-1-[4-ethoxy-3-[hydroxy(oxido)amino]cyclohexyl]ethanone |
| SMILES | CCOC1CCC(C(=O)CN2CCC(C)CC2C)CC1N([O-])O |
| InChI | InChI=1S/C17H31N2O4/c1-4-23-17-6-5-14(10-15(17)19(21)22)16(20)11-18-8-7-12(2)9-13(18)3/h12-15,17,21H,4-11H2,1-3H3/q-1 |
| InChIKey | WYZIOZAYEOJWFQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|