About 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol
3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol (PubChem CID 62331854) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol |
| PubChem CID | 62331854 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC1CCN(CC(C)(C)CO)C(C)C1 |
| InChI | InChI=1S/C12H25NO/c1-10-5-6-13(11(2)7-10)8-12(3,4)9-14/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | XVHAIBJZTAVHMH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol (CID 62331854) is 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol is CC1CCN(CC(C)(C)CO)C(C)C1.
What is the InChIKey of 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol?
The InChIKey is XVHAIBJZTAVHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-10-5-6-13(11(2)7-10)8-12(3,4)9-14/h10-11,14H,5-9H2,1-4H3.
What are the key properties of 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol?
3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol has a molecular weight of 199.34 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylpiperidin-1-yl)-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 62331854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).