C16H31N2O4+ — CID 163155834
2-ethoxy-N-hydroxy-5-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide (PubChem CID 163155834) has the molecular formula C16H31N2O4+ and a molecular weight of 315.43 g/mol. Its IUPAC name is 2-ethoxy-N-hydroxy-5-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide.
| Compound Name | 2-ethoxy-N-hydroxy-5-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163155834 |
| Molecular Formula | C16H31N2O4+ |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2-ethoxy-N-hydroxy-5-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide |
| SMILES | CCOC1CCC(C(=O)C[NH+]2CCCC(C)C2)CC1[NH+]([O-])O |
| InChI | InChI=1S/C16H30N2O4/c1-3-22-16-7-6-13(9-14(16)18(20)21)15(19)11-17-8-4-5-12(2)10-17/h12-14,16,18,20H,3-11H2,1-2H3/p+1 |
| InChIKey | QEFWSWZPCDIRAU-UHFFFAOYSA-O |
| XLogP | -0.78 |
| TPSA | 78.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|