C13H25N2O3+ — CID 163118753
N-hydroxy-4-(2-piperidin-1-ium-1-ylacetyl)cyclohexan-1-amine oxide (PubChem CID 163118753) has the molecular formula C13H25N2O3+ and a molecular weight of 257.35 g/mol. Its IUPAC name is N-hydroxy-4-(2-piperidin-1-ium-1-ylacetyl)cyclohexan-1-amine oxide.
| Compound Name | N-hydroxy-4-(2-piperidin-1-ium-1-ylacetyl)cyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163118753 |
| Molecular Formula | C13H25N2O3+ |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-hydroxy-4-(2-piperidin-1-ium-1-ylacetyl)cyclohexan-1-amine oxide |
| SMILES | O=C(C[NH+]1CCCCC1)C1CCC([NH+]([O-])O)CC1 |
| InChI | InChI=1S/C13H24N2O3/c16-13(10-14-8-2-1-3-9-14)11-4-6-12(7-5-11)15(17)18/h11-12,15,17H,1-10H2/p+1 |
| InChIKey | NDAUQGAEHNKOJA-UHFFFAOYSA-O |
| XLogP | -1.04 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|