C14H27N2O3+ — CID 163171817
N-hydroxy-4-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide (PubChem CID 163171817) has the molecular formula C14H27N2O3+ and a molecular weight of 271.38 g/mol. Its IUPAC name is N-hydroxy-4-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide.
| Compound Name | N-hydroxy-4-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163171817 |
| Molecular Formula | C14H27N2O3+ |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-hydroxy-4-[2-(3-methylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide |
| SMILES | CC1CCC[NH+](CC(=O)C2CCC([NH+]([O-])O)CC2)C1 |
| InChI | InChI=1S/C14H26N2O3/c1-11-3-2-8-15(9-11)10-14(17)12-4-6-13(7-5-12)16(18)19/h11-13,16,18H,2-10H2,1H3/p+1 |
| InChIKey | OOYMOINQWSGYGE-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|