C15H28N3O2+ — CID 2682146
N-(cyclohexylcarbamoyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 2682146) has the molecular formula C15H28N3O2+ and a molecular weight of 282.41 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-(cyclohexylcarbamoyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2682146 |
| Molecular Formula | C15H28N3O2+ |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | C[C@@H]1CCC[NH+](CC(=O)NC(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C15H27N3O2/c1-12-6-5-9-18(10-12)11-14(19)17-15(20)16-13-7-3-2-4-8-13/h12-13H,2-11H2,1H3,(H2,16,17,19,20)/p+1/t12-/m1/s1 |
| InChIKey | NTLKBOLVSKXUTR-GFCCVEGCSA-O |
| XLogP | 0.46 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |