C16H31N2O2+ — CID 2446990
N-cyclooctyl-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide (PubChem CID 2446990) has the molecular formula C16H31N2O2+ and a molecular weight of 283.44 g/mol. Its IUPAC name is N-cyclooctyl-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide.
| Compound Name | N-cyclooctyl-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
|---|---|
| PubChem CID | 2446990 |
| Molecular Formula | C16H31N2O2+ |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | N-cyclooctyl-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
| SMILES | C[C@@H]1C[NH+](CC(=O)NC2CCCCCCC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C16H30N2O2/c1-13-10-18(11-14(2)20-13)12-16(19)17-15-8-6-4-3-5-7-9-15/h13-15H,3-12H2,1-2H3,(H,17,19)/p+1/t13-,14-/m1/s1 |
| InChIKey | LCZQFLJGCCWETI-ZIAGYGMSSA-O |
| XLogP | 0.91 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |