C17H31N2O3+ — CID 163136862
3-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide (PubChem CID 163136862) has the molecular formula C17H31N2O3+ and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide.
| Compound Name | 3-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163136862 |
| Molecular Formula | C17H31N2O3+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | 3-[2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide |
| SMILES | O=C(C[NH+]1CCCC2CCCCC21)C1CCCC([NH+]([O-])O)C1 |
| InChI | InChI=1S/C17H30N2O3/c20-17(14-6-3-8-15(11-14)19(21)22)12-18-10-4-7-13-5-1-2-9-16(13)18/h13-16,19,21H,1-12H2/p+1 |
| InChIKey | LPLLFTWSZSOGAH-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|