C16H29ClN+ — CID 163174643
1-[(3-chlorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium (PubChem CID 163174643) has the molecular formula C16H29ClN+ and a molecular weight of 270.87 g/mol. Its IUPAC name is 1-[(3-chlorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium.
| Compound Name | 1-[(3-chlorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium |
|---|---|
| PubChem CID | 163174643 |
| Molecular Formula | C16H29ClN+ |
| Molecular Weight | 270.87 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-[(3-chlorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium |
| SMILES | ClC1CCCC(C[NH+]2CCCC3CCCCC32)C1 |
| InChI | InChI=1S/C16H28ClN/c17-15-8-3-5-13(11-15)12-18-10-4-7-14-6-1-2-9-16(14)18/h13-16H,1-12H2/p+1 |
| InChIKey | VASAIEYNNYXJER-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|