C16H31N2O2+ — CID 163121717
2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-ylmethyl)-N-hydroxycyclohexan-1-amine oxide (PubChem CID 163121717) has the molecular formula C16H31N2O2+ and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-ylmethyl)-N-hydroxycyclohexan-1-amine oxide.
| Compound Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-ylmethyl)-N-hydroxycyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163121717 |
| Molecular Formula | C16H31N2O2+ |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-ylmethyl)-N-hydroxycyclohexan-1-amine oxide |
| SMILES | [O-][NH+](O)C1CCCCC1C[NH+]1CCCC2CCCCC21 |
| InChI | InChI=1S/C16H30N2O2/c19-18(20)16-10-4-2-7-14(16)12-17-11-5-8-13-6-1-3-9-15(13)17/h13-16,18-19H,1-12H2/p+1 |
| InChIKey | ZJPVPFUQEJXXRS-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 52.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|