C24H51N4+3 — CID 158700415
1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium;2-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethylazetidin-1-ium (PubChem CID 158700415) has the molecular formula C24H51N4+3 and a molecular weight of 395.70 g/mol. Its IUPAC name is 1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium;2-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethylazetidin-1-ium.
| Compound Name | 1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium;2-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethylazetidin-1-ium |
|---|---|
| PubChem CID | 158700415 |
| Molecular Formula | C24H51N4+3 |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 395.41 |
| IUPAC Name | 1-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium;2-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethylazetidin-1-ium |
| SMILES | CCC1CN2CC[NH+]1CC2.CC[NH+]1CCC1.CC[NH+]1CCCC2CCCCC21 |
| InChI | InChI=1S/C11H21N.C8H16N2.C5H11N/c1-2-12-9-5-7-10-6-3-4-8-11(10)12;1-2-8-7-9-3-5-10(8)6-4-9;1-2-6-4-3-5-6/h10-11H,2-9H2,1H3;8H,2-7H2,1H3;2-5H2,1H3/p+3 |
| InChIKey | IHLYXOFBXVOFHO-UHFFFAOYSA-Q |
| XLogP | -0.48 |
| TPSA | 16.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |