C14H29N2O2+ — CID 163177536
2-[(2,5-dimethylpiperidin-1-ium-1-yl)methyl]-N-hydroxycyclohexan-1-amine oxide (PubChem CID 163177536) has the molecular formula C14H29N2O2+ and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-[(2,5-dimethylpiperidin-1-ium-1-yl)methyl]-N-hydroxycyclohexan-1-amine oxide.
| Compound Name | 2-[(2,5-dimethylpiperidin-1-ium-1-yl)methyl]-N-hydroxycyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163177536 |
| Molecular Formula | C14H29N2O2+ |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | 2-[(2,5-dimethylpiperidin-1-ium-1-yl)methyl]-N-hydroxycyclohexan-1-amine oxide |
| SMILES | CC1CCC(C)[NH+](CC2CCCCC2[NH+]([O-])O)C1 |
| InChI | InChI=1S/C14H28N2O2/c1-11-7-8-12(2)15(9-11)10-13-5-3-4-6-14(13)16(17)18/h11-14,16-17H,3-10H2,1-2H3/p+1 |
| InChIKey | BHKJIKMXEPYVRY-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 52.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|