C20H38N3O4+ — CID 163168064
2-ethoxy-N-hydroxy-5-[2-(2-piperidin-2-ylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide (PubChem CID 163168064) has the molecular formula C20H38N3O4+ and a molecular weight of 384.54 g/mol. Its IUPAC name is 2-ethoxy-N-hydroxy-5-[2-(2-piperidin-2-ylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide.
| Compound Name | 2-ethoxy-N-hydroxy-5-[2-(2-piperidin-2-ylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163168064 |
| Molecular Formula | C20H38N3O4+ |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 2-ethoxy-N-hydroxy-5-[2-(2-piperidin-2-ylpiperidin-1-ium-1-yl)acetyl]cyclohexan-1-amine oxide |
| SMILES | CCOC1CCC(C(=O)C[NH+]2CCCCC2C2CCCCN2)CC1[NH+]([O-])O |
| InChI | InChI=1S/C20H37N3O4/c1-2-27-20-10-9-15(13-18(20)23(25)26)19(24)14-22-12-6-4-8-17(22)16-7-3-5-11-21-16/h15-18,20-21,23,25H,2-14H2,1H3/p+1 |
| InChIKey | ODJBYVAAFPTISV-UHFFFAOYSA-O |
| XLogP | -0.52 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|