C8H16N2O — CID 18542535
1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-1-ium (PubChem CID 18542535) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-1-ium.
| Compound Name | 1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-1-ium |
|---|---|
| PubChem CID | 18542535 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-1-ium |
| SMILES | [O-][NH+]1CCNC2CCCCC21 |
| InChI | InChI=1S/C8H16N2O/c11-10-6-5-9-7-3-1-2-4-8(7)10/h7-10H,1-6H2 |
| InChIKey | QFOLKLFVWAVCTL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 39.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |