C13H25IN3O3+ — CID 163121885
3-[2-(2-amino-5-iodopiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide (PubChem CID 163121885) has the molecular formula C13H25IN3O3+ and a molecular weight of 398.27 g/mol. Its IUPAC name is 3-[2-(2-amino-5-iodopiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide.
| Compound Name | 3-[2-(2-amino-5-iodopiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163121885 |
| Molecular Formula | C13H25IN3O3+ |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3-[2-(2-amino-5-iodopiperidin-1-ium-1-yl)acetyl]-N-hydroxycyclohexan-1-amine oxide |
| SMILES | NC1CCC(I)C[NH+]1CC(=O)C1CCCC([NH+]([O-])O)C1 |
| InChI | InChI=1S/C13H24IN3O3/c14-10-4-5-13(15)16(7-10)8-12(18)9-2-1-3-11(6-9)17(19)20/h9-11,13,17,19H,1-8,15H2/p+1 |
| InChIKey | IOOGECDBZCYVDP-UHFFFAOYSA-O |
| XLogP | -1.35 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|