C17H28Cl2N2O — CID 163125556
1-(3,4-dichlorocyclohexyl)-2-(2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone (PubChem CID 163125556) has the molecular formula C17H28Cl2N2O and a molecular weight of 347.33 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-2-(2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-2-(2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 163125556 |
| Molecular Formula | C17H28Cl2N2O |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-2-(2,8-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone |
| SMILES | CC1CCCN2CC(C)N(CC(=O)C3CCC(Cl)C(Cl)C3)C12 |
| InChI | InChI=1S/C17H28Cl2N2O/c1-11-4-3-7-20-9-12(2)21(17(11)20)10-16(22)13-5-6-14(18)15(19)8-13/h11-15,17H,3-10H2,1-2H3 |
| InChIKey | ODBGLVPVPWYHCA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|