C17H29IN2O — CID 163178380
2-(2,7-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)-1-(4-iodocyclohexyl)ethanone (PubChem CID 163178380) has the molecular formula C17H29IN2O and a molecular weight of 404.34 g/mol. Its IUPAC name is 2-(2,7-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)-1-(4-iodocyclohexyl)ethanone.
| Compound Name | 2-(2,7-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)-1-(4-iodocyclohexyl)ethanone |
|---|---|
| PubChem CID | 163178380 |
| Molecular Formula | C17H29IN2O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(2,7-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)-1-(4-iodocyclohexyl)ethanone |
| SMILES | CC1CCN2CC(C)N(CC(=O)C3CCC(I)CC3)C2C1 |
| InChI | InChI=1S/C17H29IN2O/c1-12-7-8-19-10-13(2)20(17(19)9-12)11-16(21)14-3-5-15(18)6-4-14/h12-15,17H,3-11H2,1-2H3 |
| InChIKey | RPKNERBCHQLPBB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|