C17H29ClN2O — CID 163177031
1-(4-chlorocyclohexyl)-2-(2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone (PubChem CID 163177031) has the molecular formula C17H29ClN2O and a molecular weight of 312.89 g/mol. Its IUPAC name is 1-(4-chlorocyclohexyl)-2-(2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone.
| Compound Name | 1-(4-chlorocyclohexyl)-2-(2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 163177031 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-(4-chlorocyclohexyl)-2-(2,6-dimethyl-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridin-1-yl)ethanone |
| SMILES | CC1CCC2N(C1)CC(C)N2CC(=O)C1CCC(Cl)CC1 |
| InChI | InChI=1S/C17H29ClN2O/c1-12-3-8-17-19(9-12)10-13(2)20(17)11-16(21)14-4-6-15(18)7-5-14/h12-15,17H,3-11H2,1-2H3 |
| InChIKey | CZATZLWKMJZBEH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|