C17H30BrN2O+ — CID 163175956
1-(4-bromocyclohexyl)-2-(2,6-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium-1-yl)ethanone (PubChem CID 163175956) has the molecular formula C17H30BrN2O+ and a molecular weight of 358.34 g/mol. Its IUPAC name is 1-(4-bromocyclohexyl)-2-(2,6-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-(4-bromocyclohexyl)-2-(2,6-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 163175956 |
| Molecular Formula | C17H30BrN2O+ |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(4-bromocyclohexyl)-2-(2,6-dimethyl-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-1-ium-1-yl)ethanone |
| SMILES | CC1CCC2N(C1)CC(C)[NH+]2CC(=O)C1CCC(Br)CC1 |
| InChI | InChI=1S/C17H29BrN2O/c1-12-3-8-17-19(9-12)10-13(2)20(17)11-16(21)14-4-6-15(18)7-5-14/h12-15,17H,3-11H2,1-2H3/p+1 |
| InChIKey | SRDCALXRKFOILP-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|