C6H12N2OS — CID 163130550
1-(2-amino-1,3-thiazolidin-3-yl)propan-2-one (PubChem CID 163130550) has the molecular formula C6H12N2OS and a molecular weight of 160.24 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazolidin-3-yl)propan-2-one.
| Compound Name | 1-(2-amino-1,3-thiazolidin-3-yl)propan-2-one |
|---|---|
| PubChem CID | 163130550 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-(2-amino-1,3-thiazolidin-3-yl)propan-2-one |
| SMILES | CC(=O)CN1CCSC1N |
| InChI | InChI=1S/C6H12N2OS/c1-5(9)4-8-2-3-10-6(8)7/h6H,2-4,7H2,1H3 |
| InChIKey | RPFOKZXWEAFJQX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |