C22H28N7O4+ — CID 156677261
6-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2,4,7,8-tetramethyl-5H-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 156677261) has the molecular formula C22H28N7O4+ and a molecular weight of 454.51 g/mol. Its IUPAC name is 6-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2,4,7,8-tetramethyl-5H-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2,4,7,8-tetramethyl-5H-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 156677261 |
| Molecular Formula | C22H28N7O4+ |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 6-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2,4,7,8-tetramethyl-5H-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | Cc1c(C)[n+](CCN2CCN(C(=O)c3ccco3)CC2)c2[nH]c3c(c(=O)n(C)c(=O)n3C)n12 |
| InChI | InChI=1S/C22H27N7O4/c1-14-15(2)29-17-18(24(3)22(32)25(4)20(17)31)23-21(29)28(14)12-9-26-7-10-27(11-8-26)19(30)16-6-5-13-33-16/h5-6,13H,7-12H2,1-4H3/p+1 |
| InChIKey | IPLIFRDWZSFUGS-UHFFFAOYSA-O |
| XLogP | -0.23 |
| TPSA | 104.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|