C32H23N3O+2 — CID 156677903
3-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-phenylcarbazole (PubChem CID 156677903) has the molecular formula C32H23N3O+2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 3-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-phenylcarbazole.
| Compound Name | 3-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-phenylcarbazole |
|---|---|
| PubChem CID | 156677903 |
| Molecular Formula | C32H23N3O+2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 3-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenoxy]-9-phenylcarbazole |
| SMILES | C[N+]1=C=[N+](c2cccc(Oc3ccc4c(c3)c3ccccc3n4-c3ccccc3)c2)c2ccccc21 |
| InChI | InChI=1S/C32H23N3O/c1-33-22-34(32-17-8-7-16-31(32)33)24-12-9-13-25(20-24)36-26-18-19-30-28(21-26)27-14-5-6-15-29(27)35(30)23-10-3-2-4-11-23/h2-21H,1H3/q+2 |
| InChIKey | ZHMBASCRAXVOTG-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 20.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|